C11H17F3O — CID 123209839
10,10,10-trifluoro-3-methylidenedec-4-en-2-ol (PubChem CID 123209839) has the molecular formula C11H17F3O and a molecular weight of 222.25 g/mol. Its IUPAC name is 10,10,10-trifluoro-3-methylidenedec-4-en-2-ol.
| Compound Name | 10,10,10-trifluoro-3-methylidenedec-4-en-2-ol |
|---|---|
| PubChem CID | 123209839 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 10,10,10-trifluoro-3-methylidenedec-4-en-2-ol |
| SMILES | C=C(C=CCCCCC(F)(F)F)C(C)O |
| InChI | InChI=1S/C11H17F3O/c1-9(10(2)15)7-5-3-4-6-8-11(12,13)14/h5,7,10,15H,1,3-4,6,8H2,2H3 |
| InChIKey | HMGYTCYSJSWLMK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|