C14H23N3O — CID 123210536
2,5-diamino-N-(3,4-dimethylphenyl)-3-methylpentanamide (PubChem CID 123210536) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 2,5-diamino-N-(3,4-dimethylphenyl)-3-methylpentanamide.
| Compound Name | 2,5-diamino-N-(3,4-dimethylphenyl)-3-methylpentanamide |
|---|---|
| PubChem CID | 123210536 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2,5-diamino-N-(3,4-dimethylphenyl)-3-methylpentanamide |
| SMILES | Cc1ccc(NC(=O)C(N)C(C)CCN)cc1C |
| InChI | InChI=1S/C14H23N3O/c1-9-4-5-12(8-11(9)3)17-14(18)13(16)10(2)6-7-15/h4-5,8,10,13H,6-7,15-16H2,1-3H3,(H,17,18) |
| InChIKey | GCHJZPQBGHMIBZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |