C9H13N — CID 123211440
2,6-dimethyl-4,5-dihydroazocine (PubChem CID 123211440) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2,6-dimethyl-4,5-dihydroazocine.
| Compound Name | 2,6-dimethyl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 123211440 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2,6-dimethyl-4,5-dihydroazocine |
| SMILES | CC1=C/C=N\C(C)=CCC1 |
| InChI | InChI=1S/C9H13N/c1-8-4-3-5-9(2)10-7-6-8/h5-7H,3-4H2,1-2H3/b8-6?,9-5?,10-7- |
| InChIKey | AWHNVEBUWYLCPI-JHNNTLIUSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |