C29H40NO2S+ — CID 123211813
2-(6-butyl-3-pentan-3-yl-1-benzothiophen-2-yl)-1-(4-methoxypent-2-en-2-yloxymethyl)pyridin-1-ium (PubChem CID 123211813) has the molecular formula C29H40NO2S+ and a molecular weight of 466.71 g/mol. Its IUPAC name is 2-(6-butyl-3-pentan-3-yl-1-benzothiophen-2-yl)-1-(4-methoxypent-2-en-2-yloxymethyl)pyridin-1-ium.
| Compound Name | 2-(6-butyl-3-pentan-3-yl-1-benzothiophen-2-yl)-1-(4-methoxypent-2-en-2-yloxymethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 123211813 |
| Molecular Formula | C29H40NO2S+ |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 2-(6-butyl-3-pentan-3-yl-1-benzothiophen-2-yl)-1-(4-methoxypent-2-en-2-yloxymethyl)pyridin-1-ium |
| SMILES | CCCCc1ccc2c(C(CC)CC)c(-c3cccc[n+]3COC(C)=CC(C)OC)sc2c1 |
| InChI | InChI=1S/C29H40NO2S/c1-7-10-13-23-15-16-25-27(19-23)33-29(28(25)24(8-2)9-3)26-14-11-12-17-30(26)20-32-22(5)18-21(4)31-6/h11-12,14-19,21,24H,7-10,13,20H2,1-6H3/q+1 |
| InChIKey | MRRIFZOWDRZILK-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|