C19H22N2S — CID 25265810
N-methyl-N-(114C)methyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1-benzothiophen-2-yl]ethanamine (PubChem CID 25265810) has the molecular formula C19H22N2S and a molecular weight of 312.46 g/mol. Its IUPAC name is N-methyl-N-(114C)methyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1-benzothiophen-2-yl]ethanamine.
| Compound Name | N-methyl-N-(114C)methyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1-benzothiophen-2-yl]ethanamine |
|---|---|
| PubChem CID | 25265810 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-methyl-N-(114C)methyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1-benzothiophen-2-yl]ethanamine |
| SMILES | C[C@@H](c1ccccn1)c1c(CCN(C)[14CH3])sc2ccccc12 |
| InChI | InChI=1S/C19H22N2S/c1-14(16-9-6-7-12-20-16)19-15-8-4-5-10-17(15)22-18(19)11-13-21(2)3/h4-10,12,14H,11,13H2,1-3H3/t14-/m0/s1/i2+2 |
| InChIKey | NANQRVOKMXDMNL-DNYMGTKASA-N |
| XLogP | 4.55 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |