C20H22N2S — CID 69217775
2-[(1S)-1-[2-[2-(azetidin-1-yl)ethyl]-1-benzothiophen-3-yl]ethyl]pyridine (PubChem CID 69217775) has the molecular formula C20H22N2S and a molecular weight of 322.48 g/mol. Its IUPAC name is 2-[(1S)-1-[2-[2-(azetidin-1-yl)ethyl]-1-benzothiophen-3-yl]ethyl]pyridine.
| Compound Name | 2-[(1S)-1-[2-[2-(azetidin-1-yl)ethyl]-1-benzothiophen-3-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 69217775 |
| Molecular Formula | C20H22N2S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-[(1S)-1-[2-[2-(azetidin-1-yl)ethyl]-1-benzothiophen-3-yl]ethyl]pyridine |
| SMILES | C[C@H](c1ccccn1)c1c(CCN2CCC2)sc2ccccc12 |
| InChI | InChI=1S/C20H22N2S/c1-15(17-8-4-5-11-21-17)20-16-7-2-3-9-18(16)23-19(20)10-14-22-12-6-13-22/h2-5,7-9,11,15H,6,10,12-14H2,1H3/t15-/m1/s1 |
| InChIKey | IQWBKNWLBVZZLG-OAHLLOKOSA-N |
| XLogP | 4.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |