C36H29N3OS+2 — CID 123213340
1,11-dimethyl-10-[1-methyl-6-(3-methyldibenzothiophen-4-yl)pyridin-1-ium-2-yl]oxypyrazolo[1,5-f]phenanthridin-1-ium (PubChem CID 123213340) has the molecular formula C36H29N3OS+2 and a molecular weight of 551.72 g/mol. Its IUPAC name is 1,11-dimethyl-10-[1-methyl-6-(3-methyldibenzothiophen-4-yl)pyridin-1-ium-2-yl]oxypyrazolo[1,5-f]phenanthridin-1-ium.
| Compound Name | 1,11-dimethyl-10-[1-methyl-6-(3-methyldibenzothiophen-4-yl)pyridin-1-ium-2-yl]oxypyrazolo[1,5-f]phenanthridin-1-ium |
|---|---|
| PubChem CID | 123213340 |
| Molecular Formula | C36H29N3OS+2 |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 1,11-dimethyl-10-[1-methyl-6-(3-methyldibenzothiophen-4-yl)pyridin-1-ium-2-yl]oxypyrazolo[1,5-f]phenanthridin-1-ium |
| SMILES | Cc1ccc2c(sc3ccccc32)c1-c1cccc(Oc2ccc3c4ccccc4c4cc[n+](C)n4c3c2C)[n+]1C |
| InChI | InChI=1S/C36H29N3OS/c1-22-16-17-28-26-12-7-8-14-32(26)41-36(28)34(22)30-13-9-15-33(38(30)4)40-31-19-18-27-24-10-5-6-11-25(24)29-20-21-37(3)39(29)35(27)23(31)2/h5-21H,1-4H3/q+2 |
| InChIKey | KNBOTLYJHSIZHX-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 21.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|