C30H27N3OS+2 — CID 123846364
1-methyl-2-(3-methyldibenzothiophen-4-yl)-6-[2-methyl-3-(2-methylpyrazol-2-ium-1-yl)phenoxy]pyridin-1-ium (PubChem CID 123846364) has the molecular formula C30H27N3OS+2 and a molecular weight of 477.63 g/mol. Its IUPAC name is 1-methyl-2-(3-methyldibenzothiophen-4-yl)-6-[2-methyl-3-(2-methylpyrazol-2-ium-1-yl)phenoxy]pyridin-1-ium.
| Compound Name | 1-methyl-2-(3-methyldibenzothiophen-4-yl)-6-[2-methyl-3-(2-methylpyrazol-2-ium-1-yl)phenoxy]pyridin-1-ium |
|---|---|
| PubChem CID | 123846364 |
| Molecular Formula | C30H27N3OS+2 |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-methyl-2-(3-methyldibenzothiophen-4-yl)-6-[2-methyl-3-(2-methylpyrazol-2-ium-1-yl)phenoxy]pyridin-1-ium |
| SMILES | Cc1ccc2c(sc3ccccc32)c1-c1cccc(Oc2cccc(-n3ccc[n+]3C)c2C)[n+]1C |
| InChI | InChI=1S/C30H27N3OS/c1-20-16-17-23-22-10-5-6-14-27(22)35-30(23)29(20)25-12-8-15-28(32(25)4)34-26-13-7-11-24(21(26)2)33-19-9-18-31(33)3/h5-19H,1-4H3/q+2 |
| InChIKey | AYJAUWUMHABKHX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 21.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|