C13H14N2O — CID 123214625
N,N-dimethyl-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-amine (PubChem CID 123214625) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is N,N-dimethyl-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-amine.
| Compound Name | N,N-dimethyl-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-amine |
|---|---|
| PubChem CID | 123214625 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N,N-dimethyl-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-amine |
| SMILES | CN(C)c1ccc2c3c(ccnc13)CCO2 |
| InChI | InChI=1S/C13H14N2O/c1-15(2)10-3-4-11-12-9(6-8-16-11)5-7-14-13(10)12/h3-5,7H,6,8H2,1-2H3 |
| InChIKey | ZJFIIQKWAXEJAI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|