C14H19N — CID 123215024
N-methyl-3-(3,3,7-trimethylcyclohepta-1,4,6-trien-1-yl)prop-2-en-1-imine (PubChem CID 123215024) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is N-methyl-3-(3,3,7-trimethylcyclohepta-1,4,6-trien-1-yl)prop-2-en-1-imine.
| Compound Name | N-methyl-3-(3,3,7-trimethylcyclohepta-1,4,6-trien-1-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 123215024 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-methyl-3-(3,3,7-trimethylcyclohepta-1,4,6-trien-1-yl)prop-2-en-1-imine |
| SMILES | C/N=C/C=CC1=CC(C)(C)C=CC=C1C |
| InChI | InChI=1S/C14H19N/c1-12-7-5-9-14(2,3)11-13(12)8-6-10-15-4/h5-11H,1-4H3/b8-6?,15-10+ |
| InChIKey | ZGSWCHFCXDRHKC-JGBIDOTOSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|