C8H13NO2 — CID 123215135
4-buta-1,3-dien-2-yloxypyrrolidin-3-ol (PubChem CID 123215135) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yloxypyrrolidin-3-ol.
| Compound Name | 4-buta-1,3-dien-2-yloxypyrrolidin-3-ol |
|---|---|
| PubChem CID | 123215135 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-buta-1,3-dien-2-yloxypyrrolidin-3-ol |
| SMILES | C=CC(=C)OC1CNCC1O |
| InChI | InChI=1S/C8H13NO2/c1-3-6(2)11-8-5-9-4-7(8)10/h3,7-10H,1-2,4-5H2 |
| InChIKey | UZCQXUISOLTSCN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|