C17H24N8O — CID 123215220
3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-(3-amino-4-methylanilino)-1,2,4-triazine-6-carboxamide (PubChem CID 123215220) has the molecular formula C17H24N8O and a molecular weight of 356.43 g/mol. Its IUPAC name is 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-(3-amino-4-methylanilino)-1,2,4-triazine-6-carboxamide.
| Compound Name | 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-(3-amino-4-methylanilino)-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 123215220 |
| Molecular Formula | C17H24N8O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-(3-amino-4-methylanilino)-1,2,4-triazine-6-carboxamide |
| SMILES | Cc1ccc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)nnc2C(N)=O)cc1N |
| InChI | InChI=1S/C17H24N8O/c1-9-6-7-10(8-12(9)19)21-16-14(15(20)26)24-25-17(23-16)22-13-5-3-2-4-11(13)18/h6-8,11,13H,2-5,18-19H2,1H3,(H2,20,26)(H2,21,22,23,25)/t11-,13+/m0/s1 |
| InChIKey | JIODHGVKYXYFOX-WCQYABFASA-N |
| XLogP | 1.29 |
| TPSA | 157.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|