C26H23N7OS — CID 123215528
N-[5-[5-[diazenyl-(4-thiophen-3-yl-1H-benzimidazol-2-yl)methyl]-3-pyridinyl]-3-pyridinyl]butanamide (PubChem CID 123215528) has the molecular formula C26H23N7OS and a molecular weight of 481.59 g/mol. Its IUPAC name is N-[5-[5-[diazenyl-(4-thiophen-3-yl-1H-benzimidazol-2-yl)methyl]-3-pyridinyl]-3-pyridinyl]butanamide.
| Compound Name | N-[5-[5-[diazenyl-(4-thiophen-3-yl-1H-benzimidazol-2-yl)methyl]-3-pyridinyl]-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 123215528 |
| Molecular Formula | C26H23N7OS |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-[5-[5-[diazenyl-(4-thiophen-3-yl-1H-benzimidazol-2-yl)methyl]-3-pyridinyl]-3-pyridinyl]butanamide |
| SMILES | [H]/N=N/C(c1cncc(-c2cncc(NC(=O)CCC)c2)c1)c1nc2c(-c3ccsc3)cccc2[nH]1 |
| InChI | InChI=1S/C26H23N7OS/c1-2-4-23(34)30-20-10-18(12-29-14-20)17-9-19(13-28-11-17)24(33-27)26-31-22-6-3-5-21(25(22)32-26)16-7-8-35-15-16/h3,5-15,24,27H,2,4H2,1H3,(H,30,34)(H,31,32)/b33-27+ |
| InChIKey | CPICRLSJQKHTSE-MUGXBBEHSA-N |
| XLogP | 6.61 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|