C13H24N2O2 — CID 123215862
tert-butyl N-(1-cyclopropyl-2-methyl-3-methyliminopropan-2-yl)carbamate (PubChem CID 123215862) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is tert-butyl N-(1-cyclopropyl-2-methyl-3-methyliminopropan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-cyclopropyl-2-methyl-3-methyliminopropan-2-yl)carbamate |
|---|---|
| PubChem CID | 123215862 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | tert-butyl N-(1-cyclopropyl-2-methyl-3-methyliminopropan-2-yl)carbamate |
| SMILES | C/N=C/C(C)(CC1CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-13(4,9-14-5)8-10-6-7-10/h9-10H,6-8H2,1-5H3,(H,15,16)/b14-9+ |
| InChIKey | XRDUYQHNFNWNJX-NTEUORMPSA-N |
| XLogP | 2.77 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|