C17H34N2O4S — CID 171784798
tert-butyl N-[1-[4-(dimethylsulfamoyl)cyclohexyl]-2-methylpropan-2-yl]carbamate (PubChem CID 171784798) has the molecular formula C17H34N2O4S and a molecular weight of 362.54 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(dimethylsulfamoyl)cyclohexyl]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(dimethylsulfamoyl)cyclohexyl]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 171784798 |
| Molecular Formula | C17H34N2O4S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | tert-butyl N-[1-[4-(dimethylsulfamoyl)cyclohexyl]-2-methylpropan-2-yl]carbamate |
| SMILES | CN(C)S(=O)(=O)C1CCC(CC(C)(C)NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H34N2O4S/c1-16(2,3)23-15(20)18-17(4,5)12-13-8-10-14(11-9-13)24(21,22)19(6)7/h13-14H,8-12H2,1-7H3,(H,18,20) |
| InChIKey | RLHCEXOYYZTRET-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |