C16H22 — CID 123216377
1-methyl-10-pentan-2-ylcyclodeca-1,3,5,7,9-pentaene (PubChem CID 123216377) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-methyl-10-pentan-2-ylcyclodeca-1,3,5,7,9-pentaene.
| Compound Name | 1-methyl-10-pentan-2-ylcyclodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 123216377 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-methyl-10-pentan-2-ylcyclodeca-1,3,5,7,9-pentaene |
| SMILES | CCCC(C)c1ccccccccc1C |
| InChI | InChI=1S/C16H22/c1-4-11-14(2)16-13-10-8-6-5-7-9-12-15(16)3/h5-10,12-14H,4,11H2,1-3H3/b6-5-,7-5-,8-6-,9-7+,10-8+,12-9+,13-10+,15-12-,16-13-,16-15+ |
| InChIKey | CYQIKSCNFDXRMI-LHNWWKRPSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |