About CID 67747413
CID 67747413 (PubChem CID 67747413) has the molecular formula C30H39Sn
and a molecular weight of 518.35 g/mol.
Molecular Properties
| Compound Name | CID 67747413 |
| PubChem CID | 67747413 |
| Molecular Formula | C30H39Sn |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1C(C)C[Sn](CC(C)c1ccccc1C)CC(C)c1ccccc1C |
| InChI | InChI=1S/3C10H13.Sn/c3*1-8(2)10-7-5-4-6-9(10)3;/h3*4-8H,1H2,2-3H3; |
| InChIKey | ZLYFVHPZEDSCEV-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 67747413 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67747413?
The IUPAC name of CID 67747413 (CID 67747413) is not available.
What is the SMILES notation for CID 67747413?
The canonical SMILES for CID 67747413 is Cc1ccccc1C(C)C[Sn](CC(C)c1ccccc1C)CC(C)c1ccccc1C.
What is the InChIKey of CID 67747413?
The InChIKey is ZLYFVHPZEDSCEV-UHFFFAOYSA-N. The full InChI is InChI=1S/3C10H13.Sn/c3*1-8(2)10-7-5-4-6-9(10)3;/h3*4-8H,1H2,2-3H3;.
What are the key properties of CID 67747413?
CID 67747413 has a molecular weight of 518.35 g/mol, XLogP of 8.82, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67747413 is sourced from PubChem (CID 67747413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).