C23H30N4O3S — CID 123216395
N-[2-[4-methyl-1-[3-methyl-5-(1-methyl-2,2-dioxo-3H-2,1-benzothiazol-5-yl)-4-pyridinyl]piperidin-4-yl]ethyl]formamide (PubChem CID 123216395) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is N-[2-[4-methyl-1-[3-methyl-5-(1-methyl-2,2-dioxo-3H-2,1-benzothiazol-5-yl)-4-pyridinyl]piperidin-4-yl]ethyl]formamide.
| Compound Name | N-[2-[4-methyl-1-[3-methyl-5-(1-methyl-2,2-dioxo-3H-2,1-benzothiazol-5-yl)-4-pyridinyl]piperidin-4-yl]ethyl]formamide |
|---|---|
| PubChem CID | 123216395 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[2-[4-methyl-1-[3-methyl-5-(1-methyl-2,2-dioxo-3H-2,1-benzothiazol-5-yl)-4-pyridinyl]piperidin-4-yl]ethyl]formamide |
| SMILES | Cc1cncc(-c2ccc3c(c2)CS(=O)(=O)N3C)c1N1CCC(C)(CCNC=O)CC1 |
| InChI | InChI=1S/C23H30N4O3S/c1-17-13-25-14-20(18-4-5-21-19(12-18)15-31(29,30)26(21)3)22(17)27-10-7-23(2,8-11-27)6-9-24-16-28/h4-5,12-14,16H,6-11,15H2,1-3H3,(H,24,28) |
| InChIKey | OLPUQPWDEPPOSW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|