C21H29FN4O — CID 142304522
3,5-dimethyl-N-(1-methylpiperidin-4-yl)pyridin-4-amine;N-(4-fluoro-3-methylphenyl)formamide (PubChem CID 142304522) has the molecular formula C21H29FN4O and a molecular weight of 372.49 g/mol. Its IUPAC name is 3,5-dimethyl-N-(1-methylpiperidin-4-yl)pyridin-4-amine;N-(4-fluoro-3-methylphenyl)formamide.
| Compound Name | 3,5-dimethyl-N-(1-methylpiperidin-4-yl)pyridin-4-amine;N-(4-fluoro-3-methylphenyl)formamide |
|---|---|
| PubChem CID | 142304522 |
| Molecular Formula | C21H29FN4O |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 3,5-dimethyl-N-(1-methylpiperidin-4-yl)pyridin-4-amine;N-(4-fluoro-3-methylphenyl)formamide |
| SMILES | Cc1cc(NC=O)ccc1F.Cc1cncc(C)c1NC1CCN(C)CC1 |
| InChI | InChI=1S/C13H21N3.C8H8FNO/c1-10-8-14-9-11(2)13(10)15-12-4-6-16(3)7-5-12;1-6-4-7(10-5-11)2-3-8(6)9/h8-9,12H,4-7H2,1-3H3,(H,14,15);2-5H,1H3,(H,10,11) |
| InChIKey | VBMPZBOCHJSMBB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|