C16H26ClN3O — CID 87211381
cyclopropane;N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]formamide;hydrochloride (PubChem CID 87211381) has the molecular formula C16H26ClN3O and a molecular weight of 311.86 g/mol. Its IUPAC name is cyclopropane;N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]formamide;hydrochloride.
| Compound Name | cyclopropane;N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]formamide;hydrochloride |
|---|---|
| PubChem CID | 87211381 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | cyclopropane;N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]formamide;hydrochloride |
| SMILES | C1CC1.CN1CCC(Nc2cccc(NC=O)c2)CC1.Cl |
| InChI | InChI=1S/C13H19N3O.C3H6.ClH/c1-16-7-5-11(6-8-16)15-13-4-2-3-12(9-13)14-10-17;1-2-3-1;/h2-4,9-11,15H,5-8H2,1H3,(H,14,17);1-3H2;1H |
| InChIKey | DMROGSXCTFLPJU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|