About 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride
2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride (PubChem CID 141257396) has the molecular formula C19H23Cl2F2N3O
and a molecular weight of 418.32 g/mol. Its IUPAC name is 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride.
Molecular Properties
| Compound Name | 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride |
| PubChem CID | 141257396 |
| Molecular Formula | C19H23Cl2F2N3O |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride |
| SMILES | CN1CCC(Nc2cccc(NC(=O)c3cc(F)ccc3F)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H21F2N3O.2ClH/c1-24-9-7-14(8-10-24)22-15-3-2-4-16(12-15)23-19(25)17-11-13(20)5-6-18(17)21;;/h2-6,11-12,14,22H,7-10H2,1H3,(H,23,25);2*1H |
| InChIKey | YGZYRJHLCCGMHP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride?
The IUPAC name of 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride (CID 141257396) is 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride.
What is the SMILES notation for 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride?
The canonical SMILES for 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride is CN1CCC(Nc2cccc(NC(=O)c3cc(F)ccc3F)c2)CC1.Cl.Cl.
What is the InChIKey of 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride?
The InChIKey is YGZYRJHLCCGMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2N3O.2ClH/c1-24-9-7-14(8-10-24)22-15-3-2-4-16(12-15)23-19(25)17-11-13(20)5-6-18(17)21;;/h2-6,11-12,14,22H,7-10H2,1H3,(H,23,25);2*1H.
What are the key properties of 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride?
2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride has a molecular weight of 418.32 g/mol, XLogP of 4.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-N-[3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide;dihydrochloride is sourced from PubChem (CID 141257396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).