C19H20ClF2N3O — CID 58997345
2-chloro-4-fluoro-N-[2-fluoro-3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide (PubChem CID 58997345) has the molecular formula C19H20ClF2N3O and a molecular weight of 379.84 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[2-fluoro-3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[2-fluoro-3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 58997345 |
| Molecular Formula | C19H20ClF2N3O |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-chloro-4-fluoro-N-[2-fluoro-3-[(1-methylpiperidin-4-yl)amino]phenyl]benzamide |
| SMILES | CN1CCC(Nc2cccc(NC(=O)c3ccc(F)cc3Cl)c2F)CC1 |
| InChI | InChI=1S/C19H20ClF2N3O/c1-25-9-7-13(8-10-25)23-16-3-2-4-17(18(16)22)24-19(26)14-6-5-12(21)11-15(14)20/h2-6,11,13,23H,7-10H2,1H3,(H,24,26) |
| InChIKey | TZXKILOLIBDZGQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |