About 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride
2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride (PubChem CID 69074598) has the molecular formula C20H23Cl2FN2O2
and a molecular weight of 413.32 g/mol. Its IUPAC name is 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride.
Molecular Properties
| Compound Name | 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride |
| PubChem CID | 69074598 |
| Molecular Formula | C20H23Cl2FN2O2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride |
| SMILES | CC1CN(C)CCC1Oc1cccc(NC(=O)c2ccc(F)cc2Cl)c1.[Cl-].[H+] |
| InChI | InChI=1S/C20H22ClFN2O2.ClH/c1-13-12-24(2)9-8-19(13)26-16-5-3-4-15(11-16)23-20(25)17-7-6-14(22)10-18(17)21;/h3-7,10-11,13,19H,8-9,12H2,1-2H3,(H,23,25);1H |
| InChIKey | BHWDQJPPDXDKDT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride?
The IUPAC name of 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride (CID 69074598) is 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride.
What is the SMILES notation for 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride?
The canonical SMILES for 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride is CC1CN(C)CCC1Oc1cccc(NC(=O)c2ccc(F)cc2Cl)c1.[Cl-].[H+].
What is the InChIKey of 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride?
The InChIKey is BHWDQJPPDXDKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClFN2O2.ClH/c1-13-12-24(2)9-8-19(13)26-16-5-3-4-15(11-16)23-20(25)17-7-6-14(22)10-18(17)21;/h3-7,10-11,13,19H,8-9,12H2,1-2H3,(H,23,25);1H.
What are the key properties of 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride?
2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride has a molecular weight of 413.32 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[3-(1,3-dimethylpiperidin-4-yl)oxyphenyl]-4-fluorobenzamide;hydron;chloride is sourced from PubChem (CID 69074598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).