C12H14ClFN2O3 — CID 123216694
ethyl 2-chloro-2-[2-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)hydrazinyl]acetate (PubChem CID 123216694) has the molecular formula C12H14ClFN2O3 and a molecular weight of 288.71 g/mol. Its IUPAC name is ethyl 2-chloro-2-[2-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)hydrazinyl]acetate.
| Compound Name | ethyl 2-chloro-2-[2-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)hydrazinyl]acetate |
|---|---|
| PubChem CID | 123216694 |
| Molecular Formula | C12H14ClFN2O3 |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | ethyl 2-chloro-2-[2-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)hydrazinyl]acetate |
| SMILES | CCOC(=O)C(Cl)NNc1cc2c(cc1F)OCC2 |
| InChI | InChI=1S/C12H14ClFN2O3/c1-2-18-12(17)11(13)16-15-9-5-7-3-4-19-10(7)6-8(9)14/h5-6,11,15-16H,2-4H2,1H3 |
| InChIKey | VGGWCGRCDUXEFX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|