C23H30N2O4 — CID 123216737
9H-fluoren-9-ylmethyl N-[2-(3-aminooxy-3-methylbutoxy)propan-2-yl]carbamate (PubChem CID 123216737) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-(3-aminooxy-3-methylbutoxy)propan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-(3-aminooxy-3-methylbutoxy)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 123216737 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-(3-aminooxy-3-methylbutoxy)propan-2-yl]carbamate |
| SMILES | CC(C)(CCOC(C)(C)NC(=O)OCC1c2ccccc2-c2ccccc21)ON |
| InChI | InChI=1S/C23H30N2O4/c1-22(2,29-24)13-14-28-23(3,4)25-21(26)27-15-20-18-11-7-5-9-16(18)17-10-6-8-12-19(17)20/h5-12,20H,13-15,24H2,1-4H3,(H,25,26) |
| InChIKey | ANVDOAMYUNUVJY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|