C22H25NO4 — CID 155270949
(3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-dimethylpentanoic acid (PubChem CID 155270949) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is (3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-dimethylpentanoic acid.
| Compound Name | (3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 155270949 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-dimethylpentanoic acid |
| SMILES | CC[C@H](C)C(C)(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H25NO4/c1-4-14(2)22(3,20(24)25)23-21(26)27-13-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,14,19H,4,13H2,1-3H3,(H,23,26)(H,24,25)/t14-,22?/m0/s1 |
| InChIKey | TZBPFKBKTDHMEU-XLEXHMCLSA-N |
| XLogP | 4.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |