C22H24N2O5 — CID 171600884
(3S,4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]-4-methyl-2-oxohexanoic acid (PubChem CID 171600884) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is (3S,4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]-4-methyl-2-oxohexanoic acid.
| Compound Name | (3S,4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]-4-methyl-2-oxohexanoic acid |
|---|---|
| PubChem CID | 171600884 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (3S,4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]-4-methyl-2-oxohexanoic acid |
| SMILES | CC[C@H](C)[C@H](NNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)C(=O)O |
| InChI | InChI=1S/C22H24N2O5/c1-3-13(2)19(20(25)21(26)27)23-24-22(28)29-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,13,18-19,23H,3,12H2,1-2H3,(H,24,28)(H,26,27)/t13-,19-/m0/s1 |
| InChIKey | WSDHSIOCMWFJIC-DJJJIMSYSA-N |
| XLogP | 3.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|