C33H57O12P — CID 123217654
[3-[6-(2-ethylhexoxy)-2-methyl-3,6-dioxohex-4-en-2-yl]oxy-2-phosphonooxypropyl] 5-(2-ethylhexoxy)-5-methyl-4-oxohex-2-enoate (PubChem CID 123217654) has the molecular formula C33H57O12P and a molecular weight of 676.78 g/mol. Its IUPAC name is [3-[6-(2-ethylhexoxy)-2-methyl-3,6-dioxohex-4-en-2-yl]oxy-2-phosphonooxypropyl] 5-(2-ethylhexoxy)-5-methyl-4-oxohex-2-enoate.
| Compound Name | [3-[6-(2-ethylhexoxy)-2-methyl-3,6-dioxohex-4-en-2-yl]oxy-2-phosphonooxypropyl] 5-(2-ethylhexoxy)-5-methyl-4-oxohex-2-enoate |
|---|---|
| PubChem CID | 123217654 |
| Molecular Formula | C33H57O12P |
| Molecular Weight | 676.78 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | [3-[6-(2-ethylhexoxy)-2-methyl-3,6-dioxohex-4-en-2-yl]oxy-2-phosphonooxypropyl] 5-(2-ethylhexoxy)-5-methyl-4-oxohex-2-enoate |
| SMILES | CCCCC(CC)COC(=O)C=CC(=O)C(C)(C)OCC(COC(=O)C=CC(=O)C(C)(C)OCC(CC)CCCC)OP(=O)(O)O |
| InChI | InChI=1S/C33H57O12P/c1-9-13-15-25(11-3)21-41-30(36)19-17-29(35)33(7,8)44-24-27(45-46(38,39)40)23-42-31(37)20-18-28(34)32(5,6)43-22-26(12-4)16-14-10-2/h17-20,25-27H,9-16,21-24H2,1-8H3,(H2,38,39,40) |
| InChIKey | XBPHMELPZFNVEX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|