C32H54O9 — CID 123300141
2-[2-[5-(2-ethylhexoxy)-2,5-dioxopent-3-enoxy]propoxy]propyl 5-(2-ethylhexoxy)-4-oxopent-2-enoate (PubChem CID 123300141) has the molecular formula C32H54O9 and a molecular weight of 582.78 g/mol. Its IUPAC name is 2-[2-[5-(2-ethylhexoxy)-2,5-dioxopent-3-enoxy]propoxy]propyl 5-(2-ethylhexoxy)-4-oxopent-2-enoate.
| Compound Name | 2-[2-[5-(2-ethylhexoxy)-2,5-dioxopent-3-enoxy]propoxy]propyl 5-(2-ethylhexoxy)-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 123300141 |
| Molecular Formula | C32H54O9 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | 2-[2-[5-(2-ethylhexoxy)-2,5-dioxopent-3-enoxy]propoxy]propyl 5-(2-ethylhexoxy)-4-oxopent-2-enoate |
| SMILES | CCCCC(CC)COCC(=O)C=CC(=O)OCC(C)OCC(C)OCC(=O)C=CC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C32H54O9/c1-7-11-13-27(9-3)21-37-23-29(33)15-17-31(35)40-20-26(6)38-19-25(5)39-24-30(34)16-18-32(36)41-22-28(10-4)14-12-8-2/h15-18,25-28H,7-14,19-24H2,1-6H3 |
| InChIKey | ZMDIPRLGTFXBBG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|