C16H17N3O5 — CID 123218685
N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide (PubChem CID 123218685) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 123218685 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1C=CC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H17N3O5/c1-9-11(15(23)19-16(24)18-9)3-5-14(22)17-7-6-10-2-4-12(20)13(21)8-10/h2-5,8,20-21H,6-7H2,1H3,(H,17,22)(H2,18,19,23,24) |
| InChIKey | SILOGAXRVLSASV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|