C28H23N7O2 — CID 123219027
4-[2-[4-cyano-1-(3-ethyl-2-pyridinyl)pyrazol-5-yl]hydrazinyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide (PubChem CID 123219027) has the molecular formula C28H23N7O2 and a molecular weight of 489.54 g/mol. Its IUPAC name is 4-[2-[4-cyano-1-(3-ethyl-2-pyridinyl)pyrazol-5-yl]hydrazinyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide.
| Compound Name | 4-[2-[4-cyano-1-(3-ethyl-2-pyridinyl)pyrazol-5-yl]hydrazinyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 123219027 |
| Molecular Formula | C28H23N7O2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 4-[2-[4-cyano-1-(3-ethyl-2-pyridinyl)pyrazol-5-yl]hydrazinyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| SMILES | CCc1cccnc1-n1ncc(C#N)c1NNc1c(O)c(C(=O)Nc2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C28H23N7O2/c1-2-18-10-8-14-30-26(18)35-27(20(16-29)17-31-35)34-33-24-22-13-7-6-9-19(22)15-23(25(24)36)28(37)32-21-11-4-3-5-12-21/h3-15,17,33-34,36H,2H2,1H3,(H,32,37) |
| InChIKey | QQWHFBIVWUMNFY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|