C6H7F2N — CID 123220373
4,6-difluorocyclohex-2-en-1-imine (PubChem CID 123220373) has the molecular formula C6H7F2N and a molecular weight of 131.12 g/mol. Its IUPAC name is 4,6-difluorocyclohex-2-en-1-imine.
| Compound Name | 4,6-difluorocyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123220373 |
| Molecular Formula | C6H7F2N |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 4,6-difluorocyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\C=CC(F)CC1F |
| InChI | InChI=1S/C6H7F2N/c7-4-1-2-6(9)5(8)3-4/h1-2,4-5,9H,3H2/b9-6+ |
| InChIKey | YNBCZFKYDPIMPG-RMKNXTFCSA-N |
| XLogP | 1.64 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|