C5H7F2N — CID 134933350
(E)-1,5-difluoropent-3-en-2-imine (PubChem CID 134933350) has the molecular formula C5H7F2N and a molecular weight of 119.11 g/mol. Its IUPAC name is (E)-1,5-difluoropent-3-en-2-imine.
| Compound Name | (E)-1,5-difluoropent-3-en-2-imine |
|---|---|
| PubChem CID | 134933350 |
| Molecular Formula | C5H7F2N |
| Molecular Weight | 119.11 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | (E)-1,5-difluoropent-3-en-2-imine |
| SMILES | [H]/N=C(/C=C/CF)CF |
| InChI | InChI=1S/C5H7F2N/c6-3-1-2-5(8)4-7/h1-2,8H,3-4H2/b2-1+,8-5- |
| InChIKey | YZCQFVBJQFNYNO-VTCCBETESA-N |
| XLogP | 1.50 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.11 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|