C22H19N5O4S — CID 123220672
2-[2-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]pyrrol-1-yl]acetic acid (PubChem CID 123220672) has the molecular formula C22H19N5O4S and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-[2-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]pyrrol-1-yl]acetic acid.
| Compound Name | 2-[2-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]pyrrol-1-yl]acetic acid |
|---|---|
| PubChem CID | 123220672 |
| Molecular Formula | C22H19N5O4S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-[2-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]pyrrol-1-yl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3cccn3CC(=O)O)cc3c4c(cnc32)cnn4C)cc1 |
| InChI | InChI=1S/C22H19N5O4S/c1-14-5-7-16(8-6-14)32(30,31)27-19(18-4-3-9-26(18)13-20(28)29)10-17-21-15(11-23-22(17)27)12-24-25(21)2/h3-12H,13H2,1-2H3,(H,28,29) |
| InChIKey | MTOWEJARBKKYKN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |