C24H18N6O2S — CID 67362613
3-methyl-10-(4-methylphenyl)sulfonyl-11-quinoxalin-6-yl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 67362613) has the molecular formula C24H18N6O2S and a molecular weight of 454.52 g/mol. Its IUPAC name is 3-methyl-10-(4-methylphenyl)sulfonyl-11-quinoxalin-6-yl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-methyl-10-(4-methylphenyl)sulfonyl-11-quinoxalin-6-yl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 67362613 |
| Molecular Formula | C24H18N6O2S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 3-methyl-10-(4-methylphenyl)sulfonyl-11-quinoxalin-6-yl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3ccc4nccnc4c3)cc3c4c(cnc32)cnn4C)cc1 |
| InChI | InChI=1S/C24H18N6O2S/c1-15-3-6-18(7-4-15)33(31,32)30-22(16-5-8-20-21(11-16)26-10-9-25-20)12-19-23-17(13-27-24(19)30)14-28-29(23)2/h3-14H,1-2H3 |
| InChIKey | DZCOZRZAIGXJQF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |