C29H22BN2O — CID 123221017
CID 123221017 (PubChem CID 123221017) has the molecular formula C29H22BN2O and a molecular weight of 425.32 g/mol.
| Compound Name | CID 123221017 |
|---|---|
| PubChem CID | 123221017 |
| Molecular Formula | C29H22BN2O |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cccc3c4cc([B]O)ccc4n(c23)-c2c1n(-c1ccccc1)c1ccccc21 |
| InChI | InChI=1S/C29H22BN2O/c1-29(2)23-13-8-12-20-22-17-18(30-33)15-16-25(22)32(26(20)23)27-21-11-6-7-14-24(21)31(28(27)29)19-9-4-3-5-10-19/h3-17,33H,1-2H3 |
| InChIKey | VZFUDYXYNFYYIO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 30.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|