C13H12F3N5O2 — CID 123221868
N-imino-3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]propanamide (PubChem CID 123221868) has the molecular formula C13H12F3N5O2 and a molecular weight of 327.27 g/mol. Its IUPAC name is N-imino-3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]propanamide.
| Compound Name | N-imino-3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]propanamide |
|---|---|
| PubChem CID | 123221868 |
| Molecular Formula | C13H12F3N5O2 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-imino-3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]propanamide |
| SMILES | [H]/N=N/C(=O)CCn1cnc(-c2cc(OC)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H12F3N5O2/c1-23-10-5-8(4-9(6-10)13(14,15)16)12-18-7-21(20-12)3-2-11(22)19-17/h4-7,17H,2-3H2,1H3/b19-17+ |
| InChIKey | XIZWLGWIEMUTKQ-HTXNQAPBSA-N |
| XLogP | 2.92 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|