C16H13Br2F6N3O2 — CID 175139440
2-[[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methyl]-4,5-dibromopentanoic acid (PubChem CID 175139440) has the molecular formula C16H13Br2F6N3O2 and a molecular weight of 553.10 g/mol. Its IUPAC name is 2-[[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methyl]-4,5-dibromopentanoic acid.
| Compound Name | 2-[[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methyl]-4,5-dibromopentanoic acid |
|---|---|
| PubChem CID | 175139440 |
| Molecular Formula | C16H13Br2F6N3O2 |
| Molecular Weight | 553.10 g/mol |
| Exact Mass | 550.93 |
| IUPAC Name | 2-[[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methyl]-4,5-dibromopentanoic acid |
| SMILES | O=C(O)C(CC(Br)CBr)Cn1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H13Br2F6N3O2/c17-5-12(18)3-9(14(28)29)6-27-7-25-13(26-27)8-1-10(15(19,20)21)4-11(2-8)16(22,23)24/h1-2,4,7,9,12H,3,5-6H2,(H,28,29) |
| InChIKey | WVOUVEBYYHLZDR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.10 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|