C18H14F6N4O3 — CID 138698907
3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)propanoic acid (PubChem CID 138698907) has the molecular formula C18H14F6N4O3 and a molecular weight of 448.32 g/mol. Its IUPAC name is 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)propanoic acid.
| Compound Name | 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 138698907 |
| Molecular Formula | C18H14F6N4O3 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)propanoic acid |
| SMILES | Cc1noc(C)c1C(Cn1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)C(=O)O |
| InChI | InChI=1S/C18H14F6N4O3/c1-8-14(9(2)31-27-8)13(16(29)30)6-28-7-25-15(26-28)10-3-11(17(19,20)21)5-12(4-10)18(22,23)24/h3-5,7,13H,6H2,1-2H3,(H,29,30) |
| InChIKey | FMWNRFFWHYXLFC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |