C25H34N2O5 — CID 123222042
N-[4-ethyl-1-(hydroxymethoxymethyl)cyclohexyl]-6-methoxy-5-(2-phenylethoxy)pyridine-3-carboxamide (PubChem CID 123222042) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[4-ethyl-1-(hydroxymethoxymethyl)cyclohexyl]-6-methoxy-5-(2-phenylethoxy)pyridine-3-carboxamide.
| Compound Name | N-[4-ethyl-1-(hydroxymethoxymethyl)cyclohexyl]-6-methoxy-5-(2-phenylethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123222042 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | N-[4-ethyl-1-(hydroxymethoxymethyl)cyclohexyl]-6-methoxy-5-(2-phenylethoxy)pyridine-3-carboxamide |
| SMILES | CCC1CCC(COCO)(NC(=O)c2cnc(OC)c(OCCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C25H34N2O5/c1-3-19-9-12-25(13-10-19,17-31-18-28)27-23(29)21-15-22(24(30-2)26-16-21)32-14-11-20-7-5-4-6-8-20/h4-8,15-16,19,28H,3,9-14,17-18H2,1-2H3,(H,27,29) |
| InChIKey | BTWGYPAYGYSPRA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|