C20H30N2O6 — CID 100652190
4-ethyl-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 100652190) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-ethyl-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 100652190 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 4-ethyl-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(NC(=O)Nc2ccc(OC)c(OCCOC)c2)(C(=O)O)CC1 |
| InChI | InChI=1S/C20H30N2O6/c1-4-14-7-9-20(10-8-14,18(23)24)22-19(25)21-15-5-6-16(27-3)17(13-15)28-12-11-26-2/h5-6,13-14H,4,7-12H2,1-3H3,(H,23,24)(H2,21,22,25) |
| InChIKey | RPOABTQFYHVHQO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|