C18H20INO5 — CID 55624151
2-(4-iodophenoxy)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]acetamide (PubChem CID 55624151) has the molecular formula C18H20INO5 and a molecular weight of 457.26 g/mol. Its IUPAC name is 2-(4-iodophenoxy)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]acetamide.
| Compound Name | 2-(4-iodophenoxy)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 55624151 |
| Molecular Formula | C18H20INO5 |
| Molecular Weight | 457.26 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 2-(4-iodophenoxy)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]acetamide |
| SMILES | COCCOc1cc(NC(=O)COc2ccc(I)cc2)ccc1OC |
| InChI | InChI=1S/C18H20INO5/c1-22-9-10-24-17-11-14(5-8-16(17)23-2)20-18(21)12-25-15-6-3-13(19)4-7-15/h3-8,11H,9-10,12H2,1-2H3,(H,20,21) |
| InChIKey | JBTYUVMQMKTMMA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|