C20H22BrNO4 — CID 55624123
1-(3-bromophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]cyclopropane-1-carboxamide (PubChem CID 55624123) has the molecular formula C20H22BrNO4 and a molecular weight of 420.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55624123 |
| Molecular Formula | C20H22BrNO4 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 1-(3-bromophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]cyclopropane-1-carboxamide |
| SMILES | COCCOc1cc(NC(=O)C2(c3cccc(Br)c3)CC2)ccc1OC |
| InChI | InChI=1S/C20H22BrNO4/c1-24-10-11-26-18-13-16(6-7-17(18)25-2)22-19(23)20(8-9-20)14-4-3-5-15(21)12-14/h3-7,12-13H,8-11H2,1-2H3,(H,22,23) |
| InChIKey | TZXGINBUPCZTEB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|