C15H20ClN4OS+ — CID 123222084
[tert-butyl(methyl)amino]-(4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl)-oxoazanium (PubChem CID 123222084) has the molecular formula C15H20ClN4OS+ and a molecular weight of 339.87 g/mol. Its IUPAC name is [tert-butyl(methyl)amino]-(4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl)-oxoazanium.
| Compound Name | [tert-butyl(methyl)amino]-(4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl)-oxoazanium |
|---|---|
| PubChem CID | 123222084 |
| Molecular Formula | C15H20ClN4OS+ |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [tert-butyl(methyl)amino]-(4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl)-oxoazanium |
| SMILES | CN([N+](=O)C1CCc2c(sc3ncnc(Cl)c23)C1)C(C)(C)C |
| InChI | InChI=1S/C15H20ClN4OS/c1-15(2,3)19(4)20(21)9-5-6-10-11(7-9)22-14-12(10)13(16)17-8-18-14/h8-9H,5-7H2,1-4H3/q+1 |
| InChIKey | HJGRUFBGXBUHOC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|