C22H26ClN3O3S — CID 144676010
4-chloro-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine;(3Z,5Z)-hepta-1,3,5-triene;2-oxo-1,3-oxazolidine-3-carbaldehyde (PubChem CID 144676010) has the molecular formula C22H26ClN3O3S and a molecular weight of 447.99 g/mol. Its IUPAC name is 4-chloro-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine;(3Z,5Z)-hepta-1,3,5-triene;2-oxo-1,3-oxazolidine-3-carbaldehyde.
| Compound Name | 4-chloro-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine;(3Z,5Z)-hepta-1,3,5-triene;2-oxo-1,3-oxazolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 144676010 |
| Molecular Formula | C22H26ClN3O3S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 4-chloro-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine;(3Z,5Z)-hepta-1,3,5-triene;2-oxo-1,3-oxazolidine-3-carbaldehyde |
| SMILES | C=C/C=C\C=C/C.CC1CCc2c(sc3ncnc(Cl)c23)C1.O=CN1CCOC1=O |
| InChI | InChI=1S/C11H11ClN2S.C7H10.C4H5NO3/c1-6-2-3-7-8(4-6)15-11-9(7)10(12)13-5-14-11;1-3-5-7-6-4-2;6-3-5-1-2-8-4(5)7/h5-6H,2-4H2,1H3;3-7H,1H2,2H3;3H,1-2H2/b;6-4-,7-5-; |
| InChIKey | WYONKNWKGJQIFY-SBMQUTPRSA-N |
| XLogP | 5.37 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|