C23H21F3N2O5 — CID 123222246
5-[4-[(1R,2S,6R,7S)-3,5-dioxo-10-oxatricyclo[5.2.1.02,6]decan-4-yl]-3,5-dimethylphenoxy]-1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde (PubChem CID 123222246) has the molecular formula C23H21F3N2O5 and a molecular weight of 462.42 g/mol. Its IUPAC name is 5-[4-[(1R,2S,6R,7S)-3,5-dioxo-10-oxatricyclo[5.2.1.02,6]decan-4-yl]-3,5-dimethylphenoxy]-1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde.
| Compound Name | 5-[4-[(1R,2S,6R,7S)-3,5-dioxo-10-oxatricyclo[5.2.1.02,6]decan-4-yl]-3,5-dimethylphenoxy]-1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 123222246 |
| Molecular Formula | C23H21F3N2O5 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 5-[4-[(1R,2S,6R,7S)-3,5-dioxo-10-oxatricyclo[5.2.1.02,6]decan-4-yl]-3,5-dimethylphenoxy]-1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
| SMILES | Cc1cc(Oc2c(C=O)c(C(F)(F)F)nn2C)cc(C)c1C1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C23H21F3N2O5/c1-9-6-11(32-22-12(8-29)21(23(24,25)26)27-28(22)3)7-10(2)15(9)18-19(30)16-13-4-5-14(33-13)17(16)20(18)31/h6-8,13-14,16-18H,4-5H2,1-3H3/t13-,14+,16-,17+,18? |
| InChIKey | YZHASECIFLRNPV-SSAZZLEASA-N |
| XLogP | 3.69 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|