C30H50F3N3O4 — CID 123222280
tert-butyl 2-(octadeca-9,12-dienylcarbamoyl)-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate (PubChem CID 123222280) has the molecular formula C30H50F3N3O4 and a molecular weight of 573.74 g/mol. Its IUPAC name is tert-butyl 2-(octadeca-9,12-dienylcarbamoyl)-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(octadeca-9,12-dienylcarbamoyl)-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123222280 |
| Molecular Formula | C30H50F3N3O4 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.38 |
| IUPAC Name | tert-butyl 2-(octadeca-9,12-dienylcarbamoyl)-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CCCCCC=CCC=CCCCCCCCCNC(=O)C1CC(NC(=O)C(F)(F)F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H50F3N3O4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-34-26(37)25-22-24(35-27(38)30(31,32)33)23-36(25)28(39)40-29(2,3)4/h9-10,12-13,24-25H,5-8,11,14-23H2,1-4H3,(H,34,37)(H,35,38) |
| InChIKey | REQNREAYFZTTLQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|