C25H42F3N3O2 — CID 123518903
N-octadeca-9,12-dienyl-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-2-carboxamide (PubChem CID 123518903) has the molecular formula C25H42F3N3O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-octadeca-9,12-dienyl-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-2-carboxamide.
| Compound Name | N-octadeca-9,12-dienyl-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123518903 |
| Molecular Formula | C25H42F3N3O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.32 |
| IUPAC Name | N-octadeca-9,12-dienyl-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-2-carboxamide |
| SMILES | CCCCCC=CCC=CCCCCCCCCNC(=O)C1CC(NC(=O)C(F)(F)F)CN1 |
| InChI | InChI=1S/C25H42F3N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-29-23(32)22-19-21(20-30-22)31-24(33)25(26,27)28/h6-7,9-10,21-22,30H,2-5,8,11-20H2,1H3,(H,29,32)(H,31,33) |
| InChIKey | BRWBCYSFMUPQNO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|