C15H29N3O — CID 56712238
(2S,4R)-4-amino-1-[(Z)-hept-4-enyl]-N-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 56712238) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is (2S,4R)-4-amino-1-[(Z)-hept-4-enyl]-N-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-amino-1-[(Z)-hept-4-enyl]-N-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56712238 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | (2S,4R)-4-amino-1-[(Z)-hept-4-enyl]-N-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | CC/C=C\CCCN1C[C@H](N)C[C@H]1C(=O)NC(C)C |
| InChI | InChI=1S/C15H29N3O/c1-4-5-6-7-8-9-18-11-13(16)10-14(18)15(19)17-12(2)3/h5-6,12-14H,4,7-11,16H2,1-3H3,(H,17,19)/b6-5-/t13-,14+/m1/s1 |
| InChIKey | HUYITDYXVGLURW-QJTIAFMVSA-N |
| XLogP | 1.66 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|