C16H19ClO3 — CID 123222998
1-(4-chlorophenyl)-3-(2,2-dimethyloxan-4-yl)propane-1,3-dione (PubChem CID 123222998) has the molecular formula C16H19ClO3 and a molecular weight of 294.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,2-dimethyloxan-4-yl)propane-1,3-dione.
| Compound Name | 1-(4-chlorophenyl)-3-(2,2-dimethyloxan-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 123222998 |
| Molecular Formula | C16H19ClO3 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,2-dimethyloxan-4-yl)propane-1,3-dione |
| SMILES | CC1(C)CC(C(=O)CC(=O)c2ccc(Cl)cc2)CCO1 |
| InChI | InChI=1S/C16H19ClO3/c1-16(2)10-12(7-8-20-16)15(19)9-14(18)11-3-5-13(17)6-4-11/h3-6,12H,7-10H2,1-2H3 |
| InChIKey | RTQZHSSTDVZIIE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|